CymitQuimica logo

CAS 1011758-03-4

:

11-(4-Ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine

Description:
11-(4-Ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine is a chemical compound characterized by its complex structure, which includes a dibenzo[b,f][1,4]thiazepine core fused with a piperazine ring substituted with an ethyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential pharmacological activity due to its ability to interact with biological targets. The presence of the thiazepine ring suggests it may possess unique electronic and steric properties, influencing its reactivity and solubility. Additionally, the piperazine moiety is known for its role in enhancing the compound's bioavailability and pharmacokinetic profile. Such compounds are often investigated for their potential therapeutic applications, particularly in the fields of psychiatry and neurology, due to their ability to modulate neurotransmitter systems. However, specific characteristics such as melting point, solubility, and stability would require empirical data for precise determination. Overall, this compound represents a class of molecules with significant interest in medicinal chemistry and drug development.
Formula:C19H21N3S
InChI:InChI=1S/C19H21N3S/c1-2-21-11-13-22(14-12-21)19-15-7-3-5-9-17(15)23-18-10-6-4-8-16(18)20-19/h3-10H,2,11-14H2,1H3
InChI key:InChIKey=KUKQJNQKJWEVCE-UHFFFAOYSA-N
SMILES:C(C)N1CCN(C=2C=3C(SC=4C(N2)=CC=CC4)=CC=CC3)CC1
Synonyms:
  • 11-(4-Ethyl-1-piperazinyl)dibenzo[b,f][1,4]thiazepine
  • 11-(4-Ethylpiperazin-1-yl)dibenzo[b,f][1,4]thiazepine
  • Dibenzo[b,f][1,4]thiazepine, 11-(4-ethyl-1-piperazinyl)-
Found 8 products.