CymitQuimica logo

CAS 1012-81-3

:

2,5-Pyrrolidinedione, 1-(2-aminophenyl)-

Description:
2,5-Pyrrolidinedione, 1-(2-aminophenyl)-, also known as N-(2-aminophenyl)maleimide, is an organic compound characterized by its pyrrolidine ring structure with a maleimide functional group. This compound typically appears as a solid and is known for its reactivity, particularly in forming covalent bonds with nucleophiles due to the presence of the maleimide moiety. It exhibits properties such as moderate solubility in organic solvents and limited solubility in water. The presence of the amino group on the phenyl ring contributes to its potential as a building block in organic synthesis and materials science, particularly in the development of polymers and bioconjugates. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, 2,5-Pyrrolidinedione, 1-(2-aminophenyl)- is a versatile compound with applications in various chemical and pharmaceutical fields.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c11-7-3-1-2-4-8(7)12-9(13)5-6-10(12)14/h1-4H,5-6,11H2
InChI key:AKFYFUDAHYYAPB-UHFFFAOYSA-N
SMILES:C1CC(=O)N(C1=O)C2=CC=CC=C2N
Found 2 products.