
CAS 10124-68-2
:N-Octylacrylamide
Description:
N-Octylacrylamide is an organic compound classified as an acrylamide derivative, characterized by its long hydrophobic octyl chain attached to the acrylamide functional group. This substance typically appears as a colorless to pale yellow liquid or solid, depending on its form and temperature. It is known for its ability to polymerize, forming poly(N-octylacrylamide), which exhibits unique properties such as thermal responsiveness and hydrophobicity. N-Octylacrylamide is soluble in organic solvents like ethanol and acetone but has limited solubility in water due to its hydrophobic nature. This compound is often utilized in the synthesis of polymers and copolymers for applications in coatings, adhesives, and as a modifier in various materials to enhance their properties. Additionally, it has potential uses in biomedical applications, particularly in drug delivery systems and tissue engineering, owing to its biocompatibility and ability to form hydrogels. However, handling N-Octylacrylamide requires caution due to its potential toxicity and the need for appropriate safety measures during use.
Formula:C11H21NO
InChI:InChI=1S/C11H21NO/c1-3-5-6-7-8-9-10-12-11(13)4-2/h4H,2-3,5-10H2,1H3,(H,12,13)
InChI key:InChIKey=AWGZKFQMWZYCHF-UHFFFAOYSA-N
SMILES:N(CCCCCCCC)C(C=C)=O
Synonyms:- 2-Propenamide, N-octyl-
- N-Octyl-2-propenamide
- N-Octylacrlamide
- N-Octylacrylamide
- Acrylamide, N-octyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Octylprop-2-enamide
CAS:N-Octylprop-2-enamide is a monomer of methacrylic acid copolymer. It is a stable complex and has an efflux pump that can be used to transport drugs across the cell membrane. The hydroxy group, carbonyl group, and double bonds in this molecule are responsible for its optical properties. The film-forming polymer stabilizes the molecule and prevents it from evaporating or breaking down. The viscosity of this polymer is affected by the type of fatty acid used in the polymerization process and can be titrated calorimetrically. N-Octylprop-2-enamide has been shown to have an inhibitory effect on crotonic acid production in bacteria such as Acinetobacter baumannii.Formula:C11H21NOPurity:Min. 95%Molecular weight:183.29 g/mol



