CymitQuimica logo

CAS 101251-09-6

:

4-Acetamidophenylboronic Acid

Description:
4-Acetamidophenylboronic acid is an organic compound characterized by the presence of both a boronic acid functional group and an acetamide substituent on a phenyl ring. Its molecular structure features a phenyl ring substituted at the para position with an acetamido group and a boronic acid group, which contributes to its reactivity and potential applications in medicinal chemistry and materials science. This compound is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the boronic acid group, which can form reversible covalent bonds with diols. 4-Acetamidophenylboronic acid is often utilized in the synthesis of various pharmaceuticals and as a building block in organic synthesis, particularly in the development of drug candidates and in the field of bioconjugation. Its ability to form complexes with biomolecules makes it a valuable tool in chemical biology. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C8H10BNO3
InChI:InChI=1/C8H10BNO3/c1-6(11)10-8-4-2-7(3-5-8)9(12)13/h2-5,12-13H,1H3,(H,10,11)
InChI key:VYEWTHXZHHATTA-UHFFFAOYSA-N
SMILES:CC(=Nc1ccc(cc1)B(O)O)O
Synonyms:
  • 4-(Acetylaminophenyl)boronic acid
  • 4-Acetylaminophenylboronic acid
Found 8 products.