CymitQuimica logo

CAS 101278-21-1

:

DL-2,3-DIPHENYL-SUCCINIC ACID ANHYDRIDE

Description:
DL-2,3-Diphenyl-succinic acid anhydride, with the CAS number 101278-21-1, is a chemical compound characterized by its anhydride functional group derived from succinic acid. This compound typically appears as a white to off-white crystalline solid and is known for its relatively high melting point. It is soluble in organic solvents such as acetone and chloroform but has limited solubility in water. The presence of two phenyl groups contributes to its unique chemical properties, including enhanced stability and potential applications in organic synthesis and polymer chemistry. DL-2,3-Diphenyl-succinic acid anhydride can participate in various chemical reactions, including acylation and condensation reactions, making it valuable in the production of specialty chemicals and materials. Additionally, it may exhibit specific reactivity patterns due to the steric and electronic effects of the phenyl substituents. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C16H12O3
InChI:InChI=1/C16H12O3/c17-15-13(11-7-3-1-4-8-11)14(16(18)19-15)12-9-5-2-6-10-12/h1-10,13-14H/t13-,14-/m1/s1
SMILES:c1ccc(cc1)[C@@H]1[C@@H](c2ccccc2)C(=O)OC1=O
Found 3 products.