CAS 10128-71-9
:3-Hydroxy-4-pyridinecarboxylic acid
Description:
3-Hydroxy-4-pyridinecarboxylic acid, also known as 3-hydroxypyridine-4-carboxylic acid or by its common name, is a heterocyclic organic compound featuring a pyridine ring with hydroxyl and carboxylic acid functional groups. This compound is characterized by its ability to form hydrogen bonds due to the presence of the hydroxyl group, which enhances its solubility in polar solvents. It typically exhibits a white to off-white crystalline appearance and has a moderate melting point. The compound is known for its role in various biochemical processes and can act as a ligand in coordination chemistry, forming complexes with metal ions. Additionally, it has applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. Its chemical reactivity is influenced by the electron-withdrawing nature of the carboxylic acid group, which can affect its acidity and reactivity in various chemical reactions. Overall, 3-hydroxy-4-pyridinecarboxylic acid is a versatile compound with significant importance in both organic chemistry and medicinal applications.
Formula:C6H4NO3
InChI:InChI=1/C6H5NO3/c8-5-3-7-2-1-4(5)6(9)10/h1-3,8H,(H,9,10)/p-1
SMILES:c1cncc(c1C(=O)O)[O-]
Synonyms:- 3-Hydroxyisonicotinic acid
- 4-Pyridinecarboxylic acid, 3-hydroxy-
- 3-Hydroxypyridine-4-Carboxylic Acid
- 3-Hydroxypyridine-4-Carboxylate
- 3-Hydroxy-4-pyridinecaboxylic acid
- 3-Hydroxy-4-Pyridinecarboxylicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Hydroxyisonicotinic Acid
CAS:Formula:C6H5NO3Purity:>98.0%(T)(HPLC)Color and Shape:Light yellow to Brown powder to crystalineMolecular weight:139.113-Hydroxypyridine-4-carboxylic acid, 98%
CAS:<p>3-Hydroxyisonicotinic Acid is used in the preparation of chelating agents for iron and aluminum. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar pro</p>Formula:C6H4NO3Purity:98%Molecular weight:138.104-Pyridinecarboxylic acid, 3-hydroxy-
CAS:Formula:C6H5NO3Purity:95%Color and Shape:SolidMolecular weight:139.10883-Hydroxyisonicotinic acid
CAS:3-Hydroxyisonicotinic acidFormula:C6H5NO3Purity:≥95%Color and Shape: light yellow powderMolecular weight:139.11g/mol




