CAS 10128-71-9: 3-Hydroxy-4-pyridinecarboxylic acid
Description:3-Hydroxy-4-pyridinecarboxylic acid, also known as 3-hydroxypyridine-4-carboxylic acid or by its common name, is a heterocyclic organic compound featuring a pyridine ring with hydroxyl and carboxylic acid functional groups. This compound is characterized by its ability to form hydrogen bonds due to the presence of the hydroxyl group, which enhances its solubility in polar solvents. It typically exhibits a white to off-white crystalline appearance and has a moderate melting point. The compound is known for its role in various biochemical processes and can act as a ligand in coordination chemistry, forming complexes with metal ions. Additionally, it has applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of more complex molecules. Its chemical reactivity is influenced by the electron-withdrawing nature of the carboxylic acid group, which can affect its acidity and reactivity in various chemical reactions. Overall, 3-hydroxy-4-pyridinecarboxylic acid is a versatile compound with significant importance in both organic chemistry and medicinal applications.
Formula:C6H4NO3
InChI:InChI=1/C6H5NO3/c8-5-3-7-2-1-4(5)6(9)10/h1-3,8H,(H,9,10)/p-1
- Synonyms:
- 3-Hydroxyisonicotinic acid
- 4-Pyridinecarboxylic acid, 3-hydroxy-
- 3-Hydroxypyridine-4-Carboxylic Acid
- 3-Hydroxypyridine-4-Carboxylate
- 3-Hydroxy-4-pyridinecaboxylic acid
- 3-Hydroxy-4-Pyridinecarboxylicacid

3-Hydroxyisonicotinic Acid
Ref: 3B-H1377
1g | 87.00 € | ||
5g | 278.00 € |

3-Hydroxypyridine-4-carboxylic acid, 98%
Ref: 02-H63465
1g | 36.00 € | ||
5g | 117.00 € |

4-Pyridinecarboxylic acid, 3-hydroxy-
Ref: IN-DA00044P
1g | 25.00 € | ||
5g | 55.00 € | ||
10g | 71.00 € | ||
25g | 137.00 € | ||
100g | 528.00 € |

3-Hydroxyisonicotinic acid
Ref: 54-OR12100
1g | 32.00 € | ||
5g | 54.00 € | ||
25g | 145.00 € |

3-Hydroxyisonicotinic acid
Ref: 10-F049820
1g | 10.00 € | ||
5g | 32.00 € | ||
10g | 58.00 € | ||
25g | 109.00 € | ||
100g | 381.00 € |

3-Hydroxyisonicotinic acid
Ref: 3D-FH24371
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |