CAS 10128-91-3
:METHYL 2-OXO-1,2-DIHYDRO-3-PYRIDINECARBOXYLATE
Description:
Methyl 2-oxo-1,2-dihydro-3-pyridinecarboxylate, with the CAS number 10128-91-3, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a keto group (C=O) and an ester functional group (–COOCH3), contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the pyridine moiety suggests that it may exhibit basic properties and can participate in various chemical reactions, such as nucleophilic substitutions or condensation reactions. Methyl 2-oxo-1,2-dihydro-3-pyridinecarboxylate is often utilized in the synthesis of pharmaceuticals and agrochemicals due to its versatile reactivity. Additionally, it may have applications in the development of biologically active compounds, making it of interest in medicinal chemistry. Proper handling and storage are essential, as with many organic compounds, to ensure safety and stability.
Formula:C7H7NO3
InChI:InChI=1/C7H7NO3/c1-11-7(10)5-3-2-4-8-6(5)9/h2-4H,1H3,(H,8,9)
SMILES:COC(=O)c1cccnc1O
Synonyms:- Specs Ae-508/36398048
- 3-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester
- Methyl 2-Oxo-1,2-Dihydropyridine-3-Carboxylate
- 2-Hydroxy nicotinic acid methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 2-hydroxynicotinate, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H7NO3Purity:97%Color and Shape:White to cream, PowderMolecular weight:153.143-Pyridinecarboxylic acid, 1,2-dihydro-2-oxo-, methyl ester
CAS:Formula:C7H7NO3Purity:97%Color and Shape:SolidMolecular weight:153.1354Methyl 1,2-dihydro-2-oxopyridine-3-carboxylate
CAS:Methyl 1,2-dihydro-2-oxopyridine-3-carboxylateFormula:C7H7NO3Purity:98%Color and Shape:Cream SolidMolecular weight:153.13538



