CAS 1013-69-0
:Noreugenin
Description:
Noreugenin, with the CAS number 1013-69-0, is a naturally occurring compound classified as a flavonoid. It is primarily derived from various plant sources and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial properties. Noreugenin exhibits a flavone structure, which contributes to its ability to interact with various biological systems. The compound has garnered interest in pharmacological research due to its potential therapeutic effects, particularly in the context of chronic diseases. Its solubility characteristics can vary, influencing its bioavailability and efficacy in biological systems. Additionally, noreugenin may play a role in modulating cellular signaling pathways, which could have implications for health and disease management. As with many phytochemicals, further studies are necessary to fully elucidate its mechanisms of action and potential applications in medicine and nutrition.
Formula:C10H8O4
InChI:InChI=1S/C10H8O4/c1-5-2-7(12)10-8(13)3-6(11)4-9(10)14-5/h2-4,11,13H,1H3
InChI key:InChIKey=NCUJRUDLFCGVOE-UHFFFAOYSA-N
SMILES:O=C1C=2C(=CC(O)=CC2O)OC(C)=C1
Synonyms:- 2-Methyl-5,7-dihydroxychromone
- 4H-1-benzopyran-4-one, 5,7-dihydroxy-2-methyl-
- 5,7-Dihydroxy-2-methyl-4H-1-benzopyran-4-one
- 5,7-Dihydroxy-2-methylchromome
- 5,7-Dihydroxy-2-methylchromone
- Chromone, 5,7-dihydroxy-2-methyl-
- Noreugenin
- RonaCare Luremin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4H-1-Benzopyran-4-one, 5,7-dihydroxy-2-methyl-
CAS:Formula:C10H8O4Purity:99%Color and Shape:SolidMolecular weight:192.1681Noreugenin
CAS:Formula:C10H8O4Purity:≥ 98.0%Color and Shape:Light brown powderMolecular weight:192.17Noreugenin
CAS:Noreugenin is a new chromone from Hymenocallis littoralis Salisb.Formula:C10H8O4Purity:99.57% - 99.62%Color and Shape:White SolidMolecular weight:192.17Ref: TM-TN1992
1mg54.00€1mL*10mM (DMSO)92.00€5mg113.00€10mg172.00€25mg284.00€50mg447.00€100mg730.00€200mg982.00€Noreugenin
CAS:Noreugenin is a flavonoid compound, which is a class of polyphenolic plant secondary metabolites. It is primarily sourced from various plant species, where it functions as part of the plant's natural defense system. Flavonoids like Noreugenin are widely recognized for their antioxidant properties, operating primarily through free radical scavenging and metal ion chelation. Noreugenin modulates cellular signaling pathways, influencing gene expression related to oxidative stress and inflammation.
Formula:C10H8O4Purity:Min. 95%Color and Shape:Beige PowderMolecular weight:192.17 g/molNoreugenin
CAS:Controlled ProductApplications Noreugenin (CAS# 1013-69-0) is a useful research chemical compound.
Formula:C10H8O4Color and Shape:NeatMolecular weight:192.168








