CAS 1013-78-1

1-(2,4-dichlorphenyl)piperazine

Description:

1-(2,4-Dichlorophenyl)piperazine, with the CAS number 1013-78-1, is a chemical compound that belongs to the class of piperazines, which are cyclic organic compounds containing a piperazine ring. This substance features a dichlorophenyl group, indicating the presence of two chlorine atoms on a phenyl ring at the 2 and 4 positions, which significantly influences its chemical properties and biological activity. It is typically a white to off-white solid and is soluble in organic solvents. The compound is known for its potential pharmacological effects, often studied for its interactions with various neurotransmitter receptors, particularly in the context of psychopharmacology. Its structure allows for various substitutions, which can lead to diverse biological activities. Safety data indicates that it should be handled with care, as with many chemical substances, due to potential toxicity and environmental impact. Overall, 1-(2,4-dichlorophenyl)piperazine is of interest in both research and pharmaceutical applications.

Formula: C10H12Cl2N2

InChI: InChI=1S/C10H12Cl2N2/c11-8-1-2-10(9(12)7-8)14-5-3-13-4-6-14/h1-2,7,13H,3-6H2

InChI key: YSJHCQGGIPTMQM-UHFFFAOYSA-N

SMILES: C1CN(CCN1)C2=C(C=C(C=C2)Cl)Cl

Synonyms:

• 1-(2,4-Dichlorophenyl)Piperazine

1-(2,4-Dichlorophenyl)piperazine

Controlled Product

CAS: 1013-78-1

Versatile small molecule scaffold

Formula: C₁₀H₁₂Cl₂N₂

Purity: Min. 95%

Molecular weight: 231.12 g/mol

Ref: 3D-BAA01378

1-(2,4-Dichlorophenyl) Piperazine

CAS: 1013-78-1

Formula: C₁₀H₁₂Cl₂N₂

Molecular weight: 231.12

Ref: ST-EA-CP-A22105