CymitQuimica logo

CAS 1013098-90-2

:

Pyrido[2,3-d]pyrimidin-7(8H)-one, 2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)-

Description:
Pyrido[2,3-d]pyrimidin-7(8H)-one, 2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)- is a complex organic compound characterized by its bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a 2-amino group, enhancing its potential for biological activity, and a cyclopentyl substituent that contributes to its hydrophobic properties. The presence of a methyl group and a pyrazole moiety further diversifies its chemical behavior and may influence its interaction with biological targets. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in hydrogen bonding and other interactions. Additionally, the compound's unique arrangement of atoms may confer specific pharmacological properties, making it a candidate for further research in drug discovery. Its CAS number, 1013098-90-2, allows for easy identification and reference in chemical databases and literature.
Formula:C16H18N6O
InChI:InChI=1S/C16H18N6O/c1-9-12-6-13(10-7-18-19-8-10)15(23)22(11-4-2-3-5-11)14(12)21-16(17)20-9/h6-8,11H,2-5H2,1H3,(H,18,19)(H2,17,20,21)
InChI key:VMGMCPMGGFUNMP-UHFFFAOYSA-N
SMILES:CC1=C2C=C(C(=O)N(C2=NC(=N1)N)C3CCCC3)C4=CNN=C4
Synonyms:
  • PI3Kα/mTOR-IN-1
  • PI3Kα/mTORIN1,PI3Kα/mTOR IN 1,PI-3Kα/mTOR-IN-1
  • Pyrido[2,3-d]pyrimidin-7(8H)-one, 2-amino-8-cyclopentyl-4-methyl-6-(1H-pyrazol-4-yl)-
  • PI3K&alpha
Found 3 products.