CymitQuimica logo

CAS 10133-22-9

:

5-(Bromomethyl)benzo[b]thiophene

Description:
5-(Bromomethyl)benzo[b]thiophene is an organic compound characterized by the presence of a bromomethyl group attached to a benzo[b]thiophene structure. This compound features a fused ring system that includes a thiophene ring, which is a five-membered aromatic ring containing sulfur, and a benzene ring. The bromomethyl group introduces a reactive site, making the compound useful in various chemical reactions, particularly in synthetic organic chemistry. The presence of the bromine atom enhances its electrophilic character, allowing for further functionalization. This compound is typically used in research and development, particularly in the synthesis of more complex organic molecules. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the sample. Additionally, safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, 5-(Bromomethyl)benzo[b]thiophene serves as a valuable intermediate in the synthesis of pharmaceuticals and other organic materials.
Formula:C9H7BrS
InChI:InChI=1S/C9H7BrS/c10-6-7-1-2-9-8(5-7)3-4-11-9/h1-5H,6H2
InChI key:InChIKey=FOQVMHRXEHFCNW-UHFFFAOYSA-N
SMILES:C(Br)C=1C=C2C(=CC1)SC=C2
Synonyms:
  • 5-(Bromomethyl)benzo[b]thiophene
  • 5-Bromomethylbenzothiophene
  • Benzo[b]thiophene, 5-(bromomethyl)-
Found 5 products.