CymitQuimica logo

CAS 101330-69-2

:

Phenol, 3-methoxy-5-[2-(3-methoxyphenyl)ethyl]-

Description:
Phenol, 3-methoxy-5-[2-(3-methoxyphenyl)ethyl]- is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. This specific compound features two methoxy groups (-OCH3) and an ethyl side chain that connects to another phenyl group, contributing to its complexity and potential biological activity. The presence of methoxy groups can enhance lipophilicity, influencing its solubility and interaction with biological systems. This compound may exhibit antioxidant properties and has been studied for its potential applications in pharmaceuticals and as a chemical intermediate. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic aromatic substitution and oxidation. As with many phenolic compounds, it may also display varying degrees of toxicity and environmental impact, necessitating careful handling and assessment in laboratory and industrial settings. Overall, the unique arrangement of functional groups in this compound contributes to its distinctive chemical behavior and potential utility in various fields.
Formula:C16H18O3
InChI:InChI=1S/C16H18O3/c1-18-15-5-3-4-12(9-15)6-7-13-8-14(17)11-16(10-13)19-2/h3-5,8-11,17H,6-7H2,1-2H3
InChI key:FDJURJXPMJANDW-UHFFFAOYSA-N
SMILES:COC1=CC=CC(=C1)CCC2=CC(=CC(=C2)OC)O
Found 7 products.