CymitQuimica logo

CAS 101349-12-6

:

1H-Indole-3-ethanol, 5-fluoro-

Description:
1H-Indole-3-ethanol, 5-fluoro- is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a hydroxyl group (-OH) at the 3-position and a fluorine atom at the 5-position of the indole ring distinguishes this compound. It typically appears as a solid or liquid, depending on the specific conditions, and is soluble in organic solvents. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various biological pathways. Its fluorine substitution can enhance lipophilicity and metabolic stability, potentially influencing its pharmacokinetic properties. Additionally, the indole moiety is known for its role in various natural products and its significance in medicinal chemistry, often associated with neuroactive and anti-inflammatory properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C10H10FNO
InChI:InChI=1S/C10H10FNO/c11-8-1-2-10-9(5-8)7(3-4-13)6-12-10/h1-2,5-6,12-13H,3-4H2
InChI key:MXTYSYXDDDVPBQ-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1F)C(=CN2)CCO
Synonyms:
  • 2-(5-Fluoro-1H-indol-3-yl)ethanol
Found 6 products.