CAS 10135-00-9
:3-BROMOBENZOTHIOPHENE-2-CARBOXALDEHYDE
Description:
3-Bromobenzothiophene-2-carboxaldehyde is an organic compound characterized by the presence of a bromine atom, a thiophene ring, and an aldehyde functional group. The compound features a benzothiophene structure, which consists of a fused benzene and thiophene ring, contributing to its aromatic properties and potential reactivity. The bromine substituent enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The aldehyde group (-CHO) is a key functional group that can participate in condensation reactions and can be further transformed into other functional groups. This compound is of interest in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. Its unique structure may also impart specific electronic and optical properties, making it suitable for applications in organic electronics or as a building block in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.
Formula:C9H5BrOS
InChI:InChI=1/C9H5BrOS/c10-9-6-3-1-2-4-7(6)12-8(9)5-11/h1-5H
SMILES:c1ccc2c(c1)c(c(C=O)s2)Br
Synonyms:- 3-Bromo-1-Benzothiophene-2-Carbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromobenzo[b]thiophene-2-carbaldehyde
CAS:3-Bromobenzo[b]thiophene-2-carbaldehydeFormula:C9H5BrOSPurity:99%Molecular weight:241.1Benzo[b]thiophene-2-carboxaldehyde, 3-bromo-
CAS:Formula:C9H5BrOSPurity:95%Color and Shape:SolidMolecular weight:241.10443-bromo-1-benzothiophene-2-carbaldehyde
CAS:3-Bromo-1-benzothiophene-2-carbaldehyde (BBTA) is a ligand that has been used extensively in supramolecular chemistry. It has a strong binding constant to formyl and chloride ions, which are important in the study of fluorescence. The tautomers of this compound have been shown to be fluorescent in dimethylformamide, and it can be easily synthesized by reacting piperidine with formaldehyde. This ligand can exist as different isomeric forms depending on the substituents on the benzene ring. 3-Bromo-1-benzothiophene-2-carbaldehyde behaves as a bidentate ligand, meaning that it binds to two different sites on an atom or molecule. The functional theory for this compound is based on the interaction between its two carbonyl groups and two halides, which lead to a series of conjugated double bonds.Formula:C9H5BrOSPurity:Min. 95%Molecular weight:241.1 g/mol



