CymitQuimica logo

CAS 101364-27-6

:

1-(3-chloropropyl)-4-(3,4-dichlorophenyl)piperazine

Description:
1-(3-Chloropropyl)-4-(3,4-dichlorophenyl)piperazine, identified by its CAS number 101364-27-6, is a chemical compound that belongs to the class of piperazine derivatives. This substance features a piperazine ring, which is a six-membered heterocyclic compound containing two nitrogen atoms. The presence of a 3-chloropropyl group and a 3,4-dichlorophenyl group contributes to its unique chemical properties and potential biological activity. Typically, such compounds may exhibit various pharmacological effects, including interactions with neurotransmitter systems, making them of interest in medicinal chemistry and drug development. The chlorinated phenyl group may enhance lipophilicity, potentially affecting the compound's ability to cross biological membranes. Additionally, the structural modifications can influence the compound's stability, solubility, and reactivity. As with many synthetic organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact. Further studies would be necessary to fully elucidate its properties and applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C13H17Cl3N2
InChI:InChI=1S/C13H17Cl3N2/c14-4-1-5-17-6-8-18(9-7-17)11-2-3-12(15)13(16)10-11/h2-3,10H,1,4-9H2
InChI key:IMTRSJYLOKKFOT-UHFFFAOYSA-N
SMILES:C1CN(CCN1CCCCl)C2=CC(=C(C=C2)Cl)Cl
Synonyms:
  • Trazodone impurity QZT-IM-2-Z5 hydrochloride
  • Trazodone Impurity QZT-IM-2-Z5 HCl
  • Piperazine, 1-(3-chloropropyl)-4-(3,4-dichlorophenyl)-
  • Trazodone Impurity QZT-IM-2-Z5
  • 1-(3-chloropropyl)-4-(3,4-dichlorophenyl)piperazine
Found 5 products.