CymitQuimica logo

CAS 101399-43-3

:

L-Alanine Benzyl Ester Benzenesulfonic Acid Salt Also See: A481515

Description:
L-Alanine Benzyl Ester Benzenesulfonic Acid Salt, with the CAS number 101399-43-3, is a chemical compound that combines the amino acid L-alanine with a benzyl ester and benzenesulfonic acid. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents, which makes it useful in various chemical applications. The presence of the sulfonic acid group enhances its solubility and reactivity, making it a valuable intermediate in organic synthesis and pharmaceutical formulations. Its structure allows for potential applications in drug delivery systems, as well as in the development of surfactants and emulsifiers. Additionally, the compound may exhibit biological activity due to the amino acid component, which could influence its interaction with biological systems. As with many chemical substances, proper handling and safety precautions are essential, as it may pose risks if ingested or improperly managed.
Formula:C16H19NO5S
InChI:InChI=1S/C10H13NO2.C6H6O3S/c1-8(11)10(12)13-7-9-5-3-2-4-6-9;7-10(8,9)6-4-2-1-3-5-6/h2-6,8H,7,11H2,1H3;1-5H,(H,7,8,9)/t8-;/m0./s1
InChI key:NMAWDKFSKUHNLF-QRPNPIFTSA-N
SMILES:C[C@@H](C(=O)OCC1=CC=CC=C1)N.C1=CC=C(C=C1)S(=O)(=O)O
Synonyms:
  • L-Alanine Benzyl Ester Benzenesulfonate
Found 3 products.