CAS 101420-79-5
:4-iodo-3-nitrobenzonitrile
Description:
4-Iodo-3-nitrobenzonitrile is an organic compound characterized by the presence of both an iodine atom and a nitro group attached to a benzene ring that also contains a nitrile functional group. Its molecular structure consists of a benzene ring substituted at the 4-position with an iodine atom and at the 3-position with a nitro group, while the nitrile (-C≡N) group is attached to the benzene ring. This compound is typically a solid at room temperature and may exhibit a pale yellow to brown color. It is known for its potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The presence of the iodine atom can enhance the compound's reactivity, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the nitro group can serve as a versatile functional group for further transformations. As with many halogenated and nitro compounds, appropriate safety measures should be taken when handling this substance due to its potential toxicity and environmental impact.
Formula:C7H3IN2O2
InChI:InChI=1/C7H3IN2O2/c8-6-2-1-5(4-9)3-7(6)10(11)12/h1-3H
SMILES:c1cc(c(cc1C#N)N(=O)=O)I
Synonyms:- 3-Nitro-4-iodo-benzonitrile
- 4-Iod-3-nitrobenzonitril
- 4-Iodo-3-nitro-benzonitrile
- Benzonitrile, 4-Iodo-3-Nitro-
- 4-Iodo-3-nitrobenzonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-Iodo-3-nitrobenzonitrile
CAS:4-Iodo-3-nitrobenzonitrileFormula:C7H3IN2O2Purity:98%Molecular weight:274.024-Iodo-3-nitrobenzonitrile
CAS:4-Iodo-3-nitrobenzonitrileFormula:C7H3IN2O2Purity:95%Color and Shape:Yellow-orange SolidMolecular weight:274.01538Benzonitrile, 4-iodo-3-nitro-
CAS:Formula:C7H3IN2O2Purity:98%Color and Shape:SolidMolecular weight:274.01544-Iodo-3-nitrobenzonitrile
CAS:Formula:C7H3IN2O2Purity:98%Color and Shape:SolidMolecular weight:274.0174-Iodo-3-nitrobenzonitrile
CAS:4-Iodo-3-nitrobenzonitrile is a chemical intermediate that can be used to synthesize other chemicals. It is an aromatic compound with the formula CHNO. 4-Iodo-3-nitrobenzonitrile can be used as a reactive building block in organic synthesis and has shown to be useful in the preparation of complex compounds that are difficult to prepare by other methods. This chemical has been shown to have high quality and is stable at room temperature.Formula:C7H3IN2O2Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:274.02 g/mol




