CymitQuimica logo

CAS 1014691-61-2

:

methyl 3-(N-(2-methoxy-4-(phenylamino)phenyl)sulfamoyl)thiophene-2-carboxylate

Description:
Methyl 3-(N-(2-methoxy-4-(phenylamino)phenyl)sulfamoyl)thiophene-2-carboxylate is a complex organic compound characterized by its unique structural features, which include a thiophene ring, a carboxylate group, and a sulfamoyl moiety. The presence of the methoxy and phenylamino groups contributes to its potential biological activity, possibly enhancing its solubility and reactivity. This compound may exhibit properties typical of sulfamoyl derivatives, such as potential antibacterial or anti-inflammatory activities, due to the sulfamoyl functional group. Additionally, the thiophene ring can impart electronic properties that may be beneficial in various applications, including pharmaceuticals and organic electronics. The compound's molecular structure suggests it could participate in hydrogen bonding and other intermolecular interactions, influencing its behavior in different environments. Overall, methyl 3-(N-(2-methoxy-4-(phenylamino)phenyl)sulfamoyl)thiophene-2-carboxylate represents a class of compounds with diverse potential applications in medicinal chemistry and materials science.
Formula:C19H18N2O5S2
InChI:InChI=1S/C19H18N2O5S2/c1-25-16-12-14(20-13-6-4-3-5-7-13)8-9-15(16)21-28(23,24)17-10-11-27-18(17)19(22)26-2/h3-12,20-21H,1-2H3
InChI key:NDFKBGWLUHKMFY-UHFFFAOYSA-N
SMILES:COC1=C(C=CC(=C1)NC2=CC=CC=C2)NS(=O)(=O)C3=C(SC=C3)C(=O)OC
Found 6 products.