CAS 101477-55-8
:Lomerizine
Description:
Lomerizine is a chemical compound primarily recognized for its use as a calcium channel blocker, which is often employed in the treatment of migraine headaches. It functions by inhibiting the influx of calcium ions through voltage-gated calcium channels, thereby reducing vascular smooth muscle contraction and promoting vasodilation. This mechanism helps alleviate migraine symptoms by improving cerebral blood flow. Lomerizine is characterized by its relatively high lipophilicity, which enhances its ability to cross biological membranes and exert its pharmacological effects. The compound has a moderate molecular weight and exhibits a specific structural configuration that contributes to its activity. Additionally, Lomerizine is known for its favorable pharmacokinetic properties, including a reasonable half-life that supports its therapeutic use. As with many medications, potential side effects may include dizziness, fatigue, or gastrointestinal disturbances, and its use should be monitored by healthcare professionals to ensure safety and efficacy.
Formula:C27H30F2N2O3
InChI:InChI=1S/C27H30F2N2O3/c1-32-24-13-8-21(26(33-2)27(24)34-3)18-30-14-16-31(17-15-30)25(19-4-9-22(28)10-5-19)20-6-11-23(29)12-7-20/h4-13,25H,14-18H2,1-3H3
InChI key:InChIKey=JQSAYKKFZOSZGJ-UHFFFAOYSA-N
SMILES:C(N1CCN(CC2=C(OC)C(OC)=C(OC)C=C2)CC1)(C3=CC=C(F)C=C3)C4=CC=C(F)C=C4
Synonyms:- 1-[Bis(4-Fluorophenyl)Methyl]-4-(2,3,4-Trimethoxybenzyl)Piperazine
- 1-[Bis(4-Fluorophenyl)Methyl]-4-[2,3,4-Trimethoxyphenylmethyl]
- 1-[Bis(4-fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
- Piperazine, 1-[bis(4-fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]-
- Lomerizine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1-[bis(4-fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
CAS:Formula:C27H30F2N2O3Molecular weight:468.5355Lomerizine Dihydrochloride
CAS:Formula:C27H30F2N2O3·2HClPurity:>98.0%(T)(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:541.46Lomerizine
CAS:Lomerizine, a blocker of diphenylmethylpiperazine Ca2+ channel, is used to prevent migraines.Formula:C27H30F2N2O3Color and Shape:SolidMolecular weight:468.541-[Bis(4-Fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine
CAS:1-[Bis(4-Fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine is a chemical compound that has been shown to be an autophagy inducer in human leukemia K562 cells. It is also known to increase the production of basic proteins and cytosolic calcium. This agent has been shown to have anti-migraine effects and may be used for the treatment of autoimmune diseases. 1-[Bis(4-Fluorophenyl)methyl]-4-[(2,3,4-trimethoxyphenyl)methyl]piperazine can be synthesized with the use of trifluoroacetic acid as a solvent. The synthesis requires a sample preparation step before it can be purified by recrystallization or column chromatography.Formula:C27H30F2N2O3Purity:Min. 95%Molecular weight:468.54 g/mol



