CymitQuimica logo

CAS 101537-64-8

:

Boc-3-aminothiophene-2-carboxylic acid

Description:
Boc-3-aminothiophene-2-carboxylic acid is a chemical compound characterized by the presence of a thiophene ring, an amino group, and a carboxylic acid functional group, along with a tert-butyloxycarbonyl (Boc) protecting group. The Boc group is commonly used in organic synthesis to protect amines during chemical reactions, allowing for selective modifications of other functional groups. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential solubility in organic solvents and moderate stability under standard laboratory conditions. The presence of the carboxylic acid group contributes to its acidity, while the amino group can participate in hydrogen bonding and nucleophilic reactions. Boc-3-aminothiophene-2-carboxylic acid may be utilized in various applications, including pharmaceutical research, where it can serve as an intermediate in the synthesis of biologically active molecules. Its unique structure allows for further functionalization, making it a valuable compound in medicinal chemistry and materials science.
Formula:C10H13NO4S
InChI:InChI=1/C10H13NO4S/c1-10(2,3)15-9(14)11-6-4-5-16-7(6)8(12)13/h4-5H,1-3H3,(H,11,14)(H,12,13)
InChI key:QAXIGPOUDYLWDU-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=Nc1ccsc1C(=O)O)O
Synonyms:
  • 2-Thiophenecarboxylic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-
  • 3-[(tert-Butoxycarbonyl)amino]thiophene-2-carboxylic acid
Found 6 products.