CymitQuimica logo

CAS 1015423-45-6

:

4,6-dibromothieno[3,4-c]furan-1,3-dione

Description:
4,6-Dibromothieno[3,4-c]furan-1,3-dione is a heterocyclic organic compound characterized by its fused thieno and furan rings, which contribute to its unique chemical properties. The presence of bromine substituents at the 4 and 6 positions enhances its reactivity and may influence its electronic properties, making it a potential candidate for various applications in organic synthesis and materials science. This compound typically exhibits a yellow to orange color, indicative of its conjugated system, which can absorb light in the visible spectrum. Its structure suggests potential applications in the development of dyes, pigments, or as intermediates in the synthesis of more complex organic molecules. Additionally, the presence of the dione functional groups implies that it may participate in various chemical reactions, such as nucleophilic additions or cycloadditions. The compound's solubility and stability can vary depending on the solvent and environmental conditions, which is crucial for its practical applications. Overall, 4,6-dibromothieno[3,4-c]furan-1,3-dione is a versatile compound with interesting chemical behavior.
Formula:C6Br2O3S
InChI:InChI=1S/C6Br2O3S/c7-3-1-2(4(8)12-3)6(10)11-5(1)9
InChI key:OQMJQMGTDSIYNQ-UHFFFAOYSA-N
SMILES:C12=C(SC(=C1C(=O)OC2=O)Br)Br
Found 5 products.