CymitQuimica logo

CAS 1015936-63-6

:

2-Bromo-1-(1,3-dimethyl-1H-pyrazol-5-yl)ethanone

Description:
2-Bromo-1-(1,3-dimethyl-1H-pyrazol-5-yl)ethanone is an organic compound characterized by the presence of a bromine atom, a pyrazole ring, and a ketone functional group. The structure features a bromo substituent on the ethyl chain, which enhances its reactivity and potential applications in organic synthesis. The pyrazole moiety contributes to the compound's biological activity, making it of interest in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its reactivity can be attributed to the electrophilic nature of the carbonyl group and the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the dimethyl substitution on the pyrazole ring may influence its steric and electronic properties, affecting its interactions with other molecules. Overall, 2-Bromo-1-(1,3-dimethyl-1H-pyrazol-5-yl)ethanone is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H9BrN2O
InChI:InChI=1S/C7H9BrN2O/c1-5-3-6(7(11)4-8)10(2)9-5/h3H,4H2,1-2H3
InChI key:InChIKey=KVFFAPKXWKOIRP-UHFFFAOYSA-N
SMILES:C(CBr)(=O)C1=CC(C)=NN1C
Synonyms:
  • 2-Bromo-1-(1,3-dimethyl-1H-pyrazol-5-yl)ethanone
  • 2-Bromo-1-(1,3-dimethyl-1H-pyrazol-5-yl)ethan-1-one
  • Ethanone, 2-bromo-1-(1,3-dimethyl-1H-pyrazol-5-yl)-
Found 4 products.