CymitQuimica logo

CAS 1015937-56-0

:

Potassium 3,5-Diiodosalicylate

Description:
Potassium 3,5-Diiodosalicylate is a chemical compound characterized by its molecular structure, which includes a salicylate backbone with two iodine atoms substituted at the 3 and 5 positions. This compound is typically a white to off-white crystalline solid, soluble in water due to the presence of the potassium ion, which enhances its solubility. It is often used in various applications, including as a reagent in organic synthesis and in medicinal chemistry for its potential biological activities. The presence of iodine in its structure may impart unique properties, such as enhanced reactivity or specific interactions with biological targets. As with many iodine-containing compounds, it may exhibit antimicrobial or antifungal properties, making it of interest in pharmaceutical research. Safety data should be consulted, as handling of iodine-containing compounds often requires precautions due to potential toxicity or environmental impact. Overall, Potassium 3,5-Diiodosalicylate represents a versatile compound with applications in both research and industry.
Formula:C7H3I2KO3
InChI:InChI=1S/C7H4I2O3.K/c8-3-1-4(7(11)12)6(10)5(9)2-3;/h1-2,10H,(H,11,12);/q;+1/p-1
InChI key:SNHIVWOGVZUVLO-UHFFFAOYSA-M
SMILES:C1=C(C=C(C(=C1C(=O)[O-])O)I)I.[K+]
Synonyms:
  • Potassium3,5-Diiodosalicylate&gt
  • Potassium 2-carboxy-4,6-diiodophenolate
Found 4 products.