CAS 1016-94-0
:2-methylphenazine
Description:
2-Methylphenazine is an organic compound characterized by its structure, which consists of a phenazine core with a methyl group attached to the second carbon of one of the phenyl rings. This compound is part of the phenazine family, which is known for its aromatic properties and potential biological activity. It typically appears as a solid at room temperature and is soluble in organic solvents. The presence of the methyl group can influence its chemical reactivity and physical properties, such as melting and boiling points. 2-Methylphenazine may exhibit fluorescence, making it of interest in various applications, including organic electronics and as a dye. Additionally, compounds in the phenazine class are often studied for their antimicrobial and antitumor activities, suggesting potential pharmaceutical relevance. However, safety data should be consulted, as with any chemical substance, to understand its toxicity and handling requirements. Overall, 2-methylphenazine represents a versatile compound with implications in both research and industrial applications.
Formula:C13H10N2
InChI:InChI=1/C13H10N2/c1-9-6-7-12-13(8-9)15-11-5-3-2-4-10(11)14-12/h2-8H,1H3
InChI key:InChIKey=OPRPTWWUMRGFMA-UHFFFAOYSA-N
SMILES:CC1=CC2=C(N=C3C(=N2)C=CC=C3)C=C1
Synonyms:- NSC 402914
- Phenazine, 2-Methyl-
- Tolazine
- 2-Methylphenazine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2-Methylphenazine
CAS:2-Methylphenazine is a medicine that immobilizes animals by depressing the central nervous system. It causes the animal to become unconscious and immobile, but does not affect consciousness or respiration. 2-Methylphenazine has been used in laboratory research to study interactions between gamma-aminobutyric acid and the brain. 2-Methylphenazine also lowers blood pressure in animals, and has been shown to increase nitrogen content in muscles when administered as a single dose. Telazol is a brand name of 2-methylphenazine, which is also used as an anesthetic for large animals such as elephants, camels, and rhinos. 2-Methylphenazine has been found to be effective against cancer cells in vitro and has been shown to decrease tumor size in rats with induced breast cancer tumors. 2-Methylphenazine can be given intravenously or orally and may cause side effects such as psychosis or behavioral changes depending on dosage level.Formula:C13H10N2Purity:Min. 95%Color and Shape:White PowderMolecular weight:194.23 g/mol


