CymitQuimica logo

CAS 1016234-89-1

:

2-AMino-4-broMo-5-fluorophenol

Description:
2-Amino-4-bromo-5-fluorophenol is an organic compound characterized by the presence of an amino group (-NH2), a bromine atom, and a fluorine atom attached to a phenolic ring. This compound features a phenol structure, which contributes to its potential reactivity and solubility in polar solvents. The amino group can participate in hydrogen bonding, enhancing its solubility in water and other polar solvents. The presence of bromine and fluorine substituents introduces unique electronic properties, potentially influencing the compound's reactivity and stability. This compound may exhibit biological activity, making it of interest in pharmaceutical research and development. Its molecular structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in organic synthesis. Additionally, the specific arrangement of substituents on the aromatic ring can affect its physical properties, such as melting point and boiling point, as well as its spectral characteristics in techniques like NMR and IR spectroscopy. Safety and handling precautions should be observed due to the presence of halogens and the potential for biological activity.
Formula:C6H5BrFNO
InChI:InChI=1S/C6H5BrFNO/c7-3-1-5(9)6(10)2-4(3)8/h1-2,10H,9H2
InChI key:MGQHWQPZDBGSTR-UHFFFAOYSA-N
SMILES:C1=C(C(=CC(=C1Br)F)O)N
Found 5 products.