
CAS 10164-73-5
:Formula:C20H36O5
InChI:InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h12-13,15-19,21-23H,2-11,14H2,1H3,(H,24,25)/b13-12+/t15-,16+,17+,18+,19+/m0/s1
InChI key:DZUXGQBLFALXCR-JQXWHSLNSA-N
SMILES:CCCCC[C@@H](/C=C/[C@H]1[C@@H](C[C@H]([C@@H]1CCCCCCC(=O)O)O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Prost-13-en-1-oic acid, 9,11,15-trihydroxy-, (9β,11α,13E,15S)-
CAS:Formula:C20H36O5Molecular weight:356.4968Prostaglandin F1β
CAS:PGF1β, a biochemical compound, functions as a pivotal mediator in inflammatory processes and plays an integral role in uterine contractions. It exhibits significant regulatory effects on platelet aggregation and vasodilation, demonstrating its critical importance in cardiovascular health. Additionally, PGF1β contributes to the regulation of kidney function and electrolyte balance, illustrating its widespread impact across various physiological systems.Formula:C20H36O5Color and Shape:SolidMolecular weight:356.5


