CymitQuimica logo

CAS 1016519-59-7

:

6-(1-Pyrrolidinyl)-3-pyridinecarbothioamide

Description:
6-(1-Pyrrolidinyl)-3-pyridinecarbothioamide, identified by its CAS number 1016519-59-7, is a chemical compound that features a pyridine ring substituted with a pyrrolidine group and a carbothioamide functional group. This compound is characterized by its potential biological activity, which may include interactions with various biological targets, making it of interest in medicinal chemistry and drug development. The presence of the pyrrolidine moiety suggests that it may exhibit properties related to central nervous system activity, while the thioamide group can influence its reactivity and binding affinity. The compound's solubility, stability, and reactivity are influenced by its functional groups, which can also affect its pharmacokinetic properties. As with many heterocyclic compounds, the specific arrangement of atoms and the electronic properties of the substituents play a crucial role in determining its overall behavior in chemical reactions and biological systems. Further studies would be necessary to fully elucidate its potential applications and mechanisms of action.
Formula:C10H13N3S
InChI:InChI=1S/C10H13N3S/c11-10(14)8-3-4-9(12-7-8)13-5-1-2-6-13/h3-4,7H,1-2,5-6H2,(H2,11,14)
InChI key:InChIKey=YXWCEKIIMQJCMD-UHFFFAOYSA-N
SMILES:C(N)(=S)C1=CC=C(N=C1)N2CCCC2
Synonyms:
  • 3-Pyridinecarbothioamide, 6-(1-pyrrolidinyl)-
  • 6-(1-Pyrrolidinyl)-3-pyridinecarbothioamide
Found 2 products.