CAS 10167-97-2
:5-METHOXY-PYRIDIN-2-YLAMINE
Description:
5-Methoxy-pyridin-2-ylamine, with the CAS number 10167-97-2, is an organic compound characterized by the presence of a pyridine ring substituted with a methoxy group and an amino group. This compound typically exhibits properties associated with both aromatic amines and heterocyclic compounds. The methoxy group contributes to its electron-donating characteristics, which can influence its reactivity and solubility in various solvents. The amino group can participate in hydrogen bonding, enhancing its potential as a ligand in coordination chemistry. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Its structural features suggest potential applications in the synthesis of more complex molecules or as intermediates in organic synthesis. The stability of 5-methoxy-pyridin-2-ylamine under standard conditions is generally good, although it may be sensitive to strong acids or bases. Overall, this compound serves as a valuable building block in both academic and industrial chemistry contexts.
Formula:C6H8N2O
InChI:InChI=1/C6H8N2O/c1-9-5-2-3-6(7)8-4-5/h2-4H,1H3,(H2,7,8)
SMILES:COc1ccc(=N)[nH]c1
Synonyms:- 5-Methoxypyridin-2-Amine
- 2-Amino-5-methoxypyridine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Amino-5-methoxypyridine
CAS:Formula:C6H8N2OPurity:>97.0%(GC)(T)Color and Shape:White or Colorless to Light orange to Yellow powder to lump to clear liquidMolecular weight:124.142-Amino-5-methoxypyridine
CAS:2-Amino-5-methoxypyridineFormula:C6H8N2OPurity:95%Molecular weight:124.142-Amino-5-methoxypyridine
CAS:2-Amino-5-methoxypyridineFormula:C6H8N2OPurity:97%Color and Shape:Brown SolidMolecular weight:124.140522-Pyridinamine, 5-methoxy-
CAS:Formula:C6H8N2OPurity:98%Color and Shape:SolidMolecular weight:124.14052-Amino-5-methoxypyridine
CAS:2-Amino-5-methoxypyridine (2AM5MP) is a synthetic compound that is used to study the nicotinic acetylcholine receptor. It has been shown that 2AM5MP can be used as an agonist for the nicotinic acetylcholine receptor, which may be due to its ability to act as a substrate for amine oxidase. This compound has been shown to have anti-cancer properties and fluoresce when exposed to positron emission tomography (PET) scans. The anti-cancer effects of 2AM5MP are thought to be due to its ability to inhibit cancer cell proliferation and induce cancer cell apoptosis.
Formula:C6H8N2OPurity:Min. 95%Molecular weight:124.14 g/mol





