CymitQuimica logo

CAS 1016731-24-0

:

benzyl 3-(aminomethyl)azetidine-1-carboxylate

Description:
Benzyl 3-(aminomethyl)azetidine-1-carboxylate is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The presence of the benzyl group indicates that it has a phenyl ring attached to a methylene (-CH2-) group, contributing to its hydrophobic characteristics. The compound features an aminomethyl substituent, which introduces an amine functional group, enhancing its potential for hydrogen bonding and reactivity. The carboxylate moiety suggests that it can participate in acid-base reactions, making it a versatile intermediate in organic synthesis. This compound may exhibit biological activity due to its structural features, potentially serving as a scaffold for drug development. Its solubility and stability can vary depending on the solvent and conditions, which are important considerations for its application in research and industry. Overall, benzyl 3-(aminomethyl)azetidine-1-carboxylate is a compound of interest in medicinal chemistry and organic synthesis due to its unique structural properties.
Formula:C12H16N2O2
InChI:InChI=1S/C12H16N2O2/c13-6-11-7-14(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11H,6-9,13H2
InChI key:BYCVYBQLKZYFBQ-UHFFFAOYSA-N
SMILES:C1C(CN1C(=O)OCC2=CC=CC=C2)CN
Synonyms:
  • 1-Cbz-3-Aminomethyl-azetidine
  • Ht831
Found 5 products.