CAS 101689-95-6
:N,N'-dihydroxypentamidine
Description:
N,N'-Dihydroxypentamidine is a chemical compound characterized by its unique structure, which includes two hydroxyl groups attached to a pentamidine backbone. This compound is known for its potential biological activity, particularly in the context of antimicrobial and antiparasitic properties. It is often studied for its efficacy against various pathogens, including those responsible for diseases such as leishmaniasis and other infections. The presence of hydroxyl groups enhances its solubility and reactivity, making it a subject of interest in medicinal chemistry. Additionally, N,N'-dihydroxypentamidine may exhibit specific interactions with biological targets, influencing its pharmacological profile. Its synthesis and characterization involve standard organic chemistry techniques, and it is typically handled with care due to its biological activity. As with many chemical substances, understanding its properties, including stability, reactivity, and potential toxicity, is crucial for its application in research and therapeutic contexts.
Formula:C19H24N4O4
InChI:InChI=1/C19H24N4O4/c20-18(22-24)14-4-8-16(9-5-14)26-12-2-1-3-13-27-17-10-6-15(7-11-17)19(21)23-25/h4-11,24-25H,1-3,12-13H2,(H2,20,22)(H2,21,23)
SMILES:C(CCOc1ccc(cc1)C(=NO)N)CCOc1ccc(cc1)C(=NO)N
Synonyms:- Benzenecarboximidamide, 4,4'-(1,5-pentanediylbis(oxy))bis(N-hydroxy-
- 4,4'-[pentane-1,5-diylbis(oxy)]bis(N'-hydroxybenzenecarboximidamide)
- N,N'-Dihydroxypentamidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pentamidine Diamidoxime
CAS:Controlled ProductApplications Pentamidine Dioxime is a diamidoxime metabolite of Pentamidine (P272500).
References Clement, B. et al.: Arzneim.-Forsch., 35, 1009 (1985); Atsriku, C. et al.: Chem.-Biol. Inter., 146, 297 (2003); Clement, B. et al.: ARrh. Pharm., 325, 61 (1992);Formula:C19H24N4O4Color and Shape:NeatMolecular weight:372.418

