CAS 1017020-32-4

Formula: C14H9BrFNO3

InChI: InChI=1S/C14H9BrFNO3/c15-9-3-1-2-8(6-9)13(18)17-12-7-10(16)4-5-11(12)14(19)20/h1-7H,(H,17,18)(H,19,20)

InChI key: LAHBDMGRJXRMBR-UHFFFAOYSA-N

SMILES: C1=CC(=CC(=C1)Br)C(=O)NC2=C(C=CC(=C2)F)C(=O)O

2-(3-bromobenzamido)-4-fluorobenzoic acid

CAS: 1017020-32-4

2-(3-bromobenzamido)-4-fluorobenzoic acid

Formula: C₁₄H₉BrFNO₃

Purity: 95%

Molecular weight: 338.128658

Ref: 54-PC1054801

2-(3-Bromobenzamido)-4-fluorobenzoic acid

CAS: 1017020-32-4

2-(3-Bromobenzamido)-4-fluorobenzoic acid is a small molecule that can be used to study the function of ion channels. It may inhibit ion channels by binding to a site outside the pore, or it may block the pore entirely. This compound is a ligand for nicotinic acetylcholine receptors (nAChRs). It has been shown to activate these receptors in both rat and human brain tissue.

Formula: C₁₄H₉BrFNO₃

Purity: Min. 95%

Molecular weight: 338.13 g/mol

Ref: 3D-SQB02032