CymitQuimica logo

CAS 10176-63-3

:

3-Pyridinecarbonitrile, 2-chloro-6-methyl-5-phenyl-

Description:
3-Pyridinecarbonitrile, 2-chloro-6-methyl-5-phenyl- is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a cyano group (-C≡N) attached to the pyridine, contributing to its reactivity and potential applications in organic synthesis. The presence of a chlorine atom at the 2-position and a methyl group at the 6-position, along with a phenyl group at the 5-position, indicates that it has multiple functional groups that can influence its chemical behavior and interactions. The compound is likely to exhibit polar characteristics due to the cyano and chloro substituents, which can affect its solubility in various solvents. Additionally, the presence of the phenyl group may enhance its stability and influence its electronic properties. Overall, this compound may be of interest in pharmaceutical chemistry and materials science due to its unique structural features and potential reactivity.
Formula:C13H9ClN2
InChI:InChI=1S/C13H9ClN2/c1-9-12(10-5-3-2-4-6-10)7-11(8-15)13(14)16-9/h2-7H,1H3
InChI key:IKKNXDBSPNSUOA-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C(=N1)Cl)C#N)C2=CC=CC=C2
Found 2 products.