CymitQuimica logo

CAS 101767-83-3

:

1-BENZYL-3-(PHENYLSULFONYL)PYRROLIDINE

Description:
1-Benzyl-3-(phenylsulfonyl)pyrrolidine is an organic compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The structure features a benzyl group and a phenylsulfonyl moiety, contributing to its unique chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents, reflecting its non-polar characteristics due to the presence of aromatic groups. The sulfonyl group enhances its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrrolidine framework is often found in biologically active compounds. Additionally, the presence of both benzyl and phenylsulfonyl groups may influence its interaction with biological targets, potentially affecting its pharmacokinetic and pharmacodynamic properties. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C17H19NO2S
InChI:InChI=1S/C17H19NO2S/c19-21(20,16-9-5-2-6-10-16)17-11-12-18(14-17)13-15-7-3-1-4-8-15/h1-10,17H,11-14H2
InChI key:OTTOUOKAVIJSMY-UHFFFAOYSA-N
SMILES:C1CN(CC1S(=O)(=O)C2=CC=CC=C2)CC3=CC=CC=C3
Found 2 products.