CymitQuimica logo

CAS 101768-14-3

:

4-Piperidinol, 1-(phenylmethyl)-, 4-methylbenzenesulfonate (ester)

Description:
4-Piperidinol, 1-(phenylmethyl)-, 4-methylbenzenesulfonate (ester), with CAS number 101768-14-3, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenylmethyl group, indicating the presence of a benzyl substituent, and a sulfonate ester functional group, which enhances its solubility and reactivity. The sulfonate moiety typically contributes to the compound's ability to participate in various chemical reactions, including nucleophilic substitutions. The presence of the methyl group on the benzene ring can influence the compound's electronic properties and steric hindrance, potentially affecting its biological activity and interactions. As an ester, it may exhibit properties typical of both alcohols and acids, making it versatile in synthetic applications. Overall, this compound's unique structure suggests potential utility in medicinal chemistry, particularly in the development of pharmaceuticals or as a reagent in organic synthesis. However, specific safety and handling information should be consulted due to the potential hazards associated with chemical substances.
Formula:C19H23NO3S
InChI:InChI=1S/C19H23NO3S/c1-16-7-9-19(10-8-16)24(21,22)23-18-11-13-20(14-12-18)15-17-5-3-2-4-6-17/h2-10,18H,11-15H2,1H3
InChI key:PZKDDWLNFPJDCG-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)S(=O)(=O)OC2CCN(CC2)CC3=CC=CC=C3
Found 3 products.