CAS 10177-29-4
:4-chloronicotinic acid
Description:
4-Chloronicotinic acid is an aromatic heterocyclic compound that belongs to the class of chlorinated pyridine derivatives. It features a pyridine ring substituted with a carboxylic acid group and a chlorine atom at the 4-position. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in polar solvents such as water, methanol, and ethanol, while being less soluble in non-polar solvents. Its molecular structure contributes to its acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. 4-Chloronicotinic acid is of interest in pharmaceutical research and organic synthesis, often serving as a building block for the development of biologically active compounds. Additionally, it may exhibit biological activities, including potential antimicrobial and anti-inflammatory properties. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks upon exposure. Proper storage and handling procedures are essential to ensure safety in laboratory and industrial settings.
Formula:C6H4ClNO2
InChI:InChI=1/C6H4ClNO2/c7-5-1-2-8-3-4(5)6(9)10/h1-3H,(H,9,10)
SMILES:c1cncc(c1Cl)C(=O)O
Synonyms:- 4-Chloropyridine-3-Carboxylic Acid
- 4-Chloro-3-Pyridinecarboxylic Acid
- Iflab-Bb F1926-0029
- 4-Chloro-3-pyridinecarboxylic
- 4-Chloronicotinic Acid,99%
- 4-Choronicotinic acid
- 4-Chloronicotinic acid ,97%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-Chloronicotinic acid, 96%
CAS:4-Chloropyridine-3-carboxylic acid is a building block used in a synthesis of benzocanthinones via tributyltin hydride radical induced cyclization. 4-Chloropyridine-3-carboxylic acid is also used in a synthesis of heterocyclic analogues of xanthone. This Thermo Scientific Chemicals brand product wasFormula:C6H4ClNO2Purity:96%Color and Shape:Powder or lumps, Pale cream to cream to yellow to pale brownMolecular weight:157.564-Chloronicotinic acid
CAS:4-Chloronicotinic acidFormula:C6H4ClNO2Purity:99%Color and Shape:Yellow SolidMolecular weight:157.554464-Chloropyridine-3-carboxylic acid
CAS:4-Chloronicotinic acidFormula:C6H4ClNO2Purity:97%Molecular weight:157.553-Pyridinecarboxylic acid, 4-chloro-
CAS:Formula:C6H4ClNO2Purity:98%Color and Shape:SolidMolecular weight:157.5545Ref: IN-DA0005G0
500gTo inquire1g29.00€5g42.00€10g56.00€25g101.00€50g159.00€100g223.00€250g507.00€1kg1,851.00€5kg9,002.00€





