CAS 101774-27-0

6-Bromoindole-3-carboxylic acid

Description:

6-Bromoindole-3-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It exhibits acidic behavior, capable of donating a proton in solution. The bromine substituent can influence the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and the development of pharmaceuticals. Additionally, 6-bromoindole-3-carboxylic acid may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Its biological activity and potential applications in drug development are areas of ongoing research, highlighting its significance in the field of medicinal chemistry.

Formula: C₉H₆BrNO₂

InChI: InChI=1/C9H6BrNO2/c10-5-1-2-6-7(9(12)13)4-11-8(6)3-5/h1-4,11H,(H,12,13)

SMILES: c1cc2c(c[nH]c2cc1Br)C(=O)O

Synonyms:

• 6-Bromo-1H-Indole-3-Carboxylic Acid
• 6-Bromo-1-(Tert-Butoxycarbonyl)-1H-Indole-3-Carboxylic Acid
• 6-bromo-1H-indole-3-carboxylic

1H-Indole-3-carboxylic acid, 6-bromo-

CAS: 101774-27-0

Formula: C₉H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 240.0534

Ref: IN-DA0005GI

6-Bromoindole-3-carboxylic acid

CAS: 101774-27-0

6-Bromoindole-3-carboxylic acid

Purity: ≥98%

Molecular weight: 240.05g/mol

Ref: 54-BUP10888

6-Bromoindole-3-carboxylic acid

CAS: 101774-27-0

6-Bromoindole-3-carboxylic acid (ZINC2547985) is a marine derived natural products found in Pseudosuberites hyalinus.

Formula: C₉H₆BrNO₂

Purity: 99.60%

Color and Shape: Solid

Molecular weight: 240.05

Ref: TM-TN7177

6-Bromo-1H-indole-3-carboxylic acid

CAS: 101774-27-0

6-Bromo-1H-indole-3-carboxylic acid

Formula: C₉H₆BrNO₂

Purity: 98%

Color and Shape: faint yellow solid

Molecular weight: 240.05g/mol

Ref: 54-OR914279

6-Bromo-1H-indole-3-carboxylic acid

CAS: 101774-27-0

6-Bromo-1H-indole-3-carboxylic acid is a natural product that is isolated from the marine sponge Smenospongia purpurea. It was first reported in 1979 and has been used for the synthesis of other compounds. 6-Bromoindole, a precursor to 6-bromo-1H-indole-3-carboxylic acid, is biosynthesized from methyl ester and NMR spectra indicate that it has a dihedral angle of 173°. This compound has been shown to have antibacterial activity against staphylococcus.

Formula: C₉H₆BrNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 240.05 g/mol

Ref: 3D-FB56690

6-Bromo-1H-indole-3-carboxylic acid

CAS: 101774-27-0

Formula: C₉H₆BrNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 240.056

Ref: 10-F080050