CAS 101774-27-0
:6-Bromoindole-3-carboxylic acid
Description:
6-Bromoindole-3-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It exhibits acidic behavior, capable of donating a proton in solution. The bromine substituent can influence the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and the development of pharmaceuticals. Additionally, 6-bromoindole-3-carboxylic acid may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Its biological activity and potential applications in drug development are areas of ongoing research, highlighting its significance in the field of medicinal chemistry.
Formula:C9H6BrNO2
InChI:InChI=1/C9H6BrNO2/c10-5-1-2-6-7(9(12)13)4-11-8(6)3-5/h1-4,11H,(H,12,13)
SMILES:c1cc2c(c[nH]c2cc1Br)C(=O)O
Synonyms:- 6-Bromo-1H-Indole-3-Carboxylic Acid
- 6-Bromo-1-(Tert-Butoxycarbonyl)-1H-Indole-3-Carboxylic Acid
- 6-bromo-1H-indole-3-carboxylic
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
6-Bromoindole-3-carboxylic acid
CAS:6-Bromoindole-3-carboxylic acidFormula:C9H6BrNO2Purity:≥98%Molecular weight:240.056-Bromo-1H-indole-3-carboxylic acid
CAS:6-Bromo-1H-indole-3-carboxylic acidFormula:C9H6BrNO2Purity:98%Molecular weight:240.051H-Indole-3-carboxylic acid, 6-bromo-
CAS:Formula:C9H6BrNO2Purity:98%Color and Shape:SolidMolecular weight:240.05346-Bromoindole-3-carboxylic acid
CAS:6-Bromoindole-3-carboxylic acid (ZINC2547985) is a marine derived natural products found in Pseudosuberites hyalinus.Formula:C9H6BrNO2Purity:99.60%Color and Shape:White SolidMolecular weight:240.056-Bromo-1H-indole-3-carboxylic acid
CAS:6-Bromo-1H-indole-3-carboxylic acidFormula:C9H6BrNO2Purity:98%Color and Shape:Yellow-brown SolidMolecular weight:240.053446-Bromo-1H-indole-3-carboxylic acid
CAS:6-Bromo-1H-indole-3-carboxylic acid is a natural product that is isolated from the marine sponge Smenospongia purpurea. It was first reported in 1979 and has been used for the synthesis of other compounds. 6-Bromoindole, a precursor to 6-bromo-1H-indole-3-carboxylic acid, is biosynthesized from methyl ester and NMR spectra indicate that it has a dihedral angle of 173°. This compound has been shown to have antibacterial activity against staphylococcus.Formula:C9H6BrNO2Purity:Min. 95%Color and Shape:PowderMolecular weight:240.05 g/mol6-Bromo-1H-indole-3-carboxylic acid
CAS:Formula:C9H6BrNO2Purity:95%Color and Shape:SolidMolecular weight:240.056





