CymitQuimica logo

CAS 101774-27-0

:

6-Bromoindole-3-carboxylic acid

Description:
6-Bromoindole-3-carboxylic acid is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 6-position and a carboxylic acid functional group at the 3-position contributes to its unique chemical properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid group. It exhibits acidic behavior, capable of donating a proton in solution. The bromine substituent can influence the compound's reactivity, making it useful in various synthetic applications, including medicinal chemistry and the development of pharmaceuticals. Additionally, 6-bromoindole-3-carboxylic acid may participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a valuable intermediate in organic synthesis. Its biological activity and potential applications in drug development are areas of ongoing research, highlighting its significance in the field of medicinal chemistry.
Formula:C9H6BrNO2
InChI:InChI=1/C9H6BrNO2/c10-5-1-2-6-7(9(12)13)4-11-8(6)3-5/h1-4,11H,(H,12,13)
InChI key:INNZWYJJSSRJET-UHFFFAOYSA-N
SMILES:c1cc2c(c[nH]c2cc1Br)C(=O)O
Synonyms:
  • 6-Bromo-1H-Indole-3-Carboxylic Acid
  • 6-Bromo-1-(Tert-Butoxycarbonyl)-1H-Indole-3-Carboxylic Acid
  • 6-bromo-1H-indole-3-carboxylic
Found 7 products.