CAS 1017777-77-3

6-Chloro-2-fluoro-3-methoxyaniline

Description:

6-Chloro-2-fluoro-3-methoxyaniline is an organic compound characterized by the presence of a chloro group, a fluoro group, and a methoxy group attached to an aniline structure. Its molecular formula typically includes carbon, hydrogen, chlorine, fluorine, and nitrogen atoms, reflecting its complex structure. The chloro and fluoro substituents contribute to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methoxy group enhances its solubility in organic solvents and may influence its electronic properties, making it a candidate for use in pharmaceuticals or agrochemicals. The compound's aniline base provides it with basic properties, allowing it to participate in various chemical transformations. Additionally, the presence of halogen atoms can affect its biological activity and environmental behavior. Overall, 6-Chloro-2-fluoro-3-methoxyaniline is a versatile compound with potential applications in synthetic organic chemistry and material science.

Formula: C7H7ClFNO

InChI: InChI=1S/C7H7ClFNO/c1-11-5-3-2-4(8)7(10)6(5)9/h2-3H,10H2,1H3

InChI key: ABRCLZVZMHSIRQ-UHFFFAOYSA-N

SMILES: COC1=C(C(=C(C=C1)Cl)N)F

6-Chloro-2-fluoro-3-methoxyaniline

CAS: 1017777-77-3

6-Chloro-2-fluoro-3-methoxyaniline

Formula: C₇H₇ClFNO

Purity: 98%

Color and Shape: Off-white Solid

Molecular weight: 175.58798

Ref: 54-PC303100

6-Chloro-2-fluoro-3-methoxyaniline

CAS: 1017777-77-3

6-Chloro-2-fluoro-3-methoxyaniline

Formula: C₇H₇ClFNO

Purity: 95%

Molecular weight: 175.59

Ref: IN-DG306959

6-Chloro-2-fluoro-3-methoxyaniline

CAS: 1017777-77-3

Formula: C₇H₇ClFNO

Purity: 95%

Color and Shape: Solid

Molecular weight: 175.59

Ref: 10-F342701

6-Chloro-2-fluoro-3-methoxyaniline

CAS: 1017777-77-3

6-Chloro-2-fluoro-3-methoxyaniline is a reactive chemical that is used in the production of 6FMA, an intermediate for the manufacture of fluoroquinolones. This compound can be synthesized by reacting hydrochloric acid with elemental magnesium. 6-Chloro-2-fluoro-3-methoxyaniline has been used to measure the efficiency of corrosion inhibitors and inhibitors. The frequency of the resonance was found to be proportional to its inhibition efficiency. The magnetic properties of this compound were studied using nuclear magnetic resonance spectroscopy.

Formula: C₇H₇ClFNO

Purity: Min. 95%

Molecular weight: 175.59 g/mol

Ref: 3D-SQB77777