CAS 1017779-46-2
:2-(Difluoromethoxy)-5-fluorobenzenemethanamine
Description:
2-(Difluoromethoxy)-5-fluorobenzenemethanamine, with the CAS number 1017779-46-2, is a chemical compound characterized by its unique molecular structure that includes a benzene ring substituted with multiple fluorine atoms and a difluoromethoxy group. This compound is typically classified as an aromatic amine due to the presence of the amine functional group (-NH2) attached to the benzene ring. The presence of fluorine atoms enhances its lipophilicity and may influence its reactivity and biological activity. The difluoromethoxy group contributes to its overall polarity and can affect its solubility in various solvents. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in pharmaceuticals and agrochemicals. Additionally, the fluorinated substituents can impart unique properties such as increased metabolic stability and altered pharmacokinetics. Safety and handling precautions should be observed, as with many fluorinated compounds, due to potential toxicity and environmental concerns.
Formula:C8H8F3NO
InChI:InChI=1S/C8H8F3NO/c9-6-1-2-7(13-8(10)11)5(3-6)4-12/h1-3,8H,4,12H2
InChI key:InChIKey=KZGCNFCITFWOCH-UHFFFAOYSA-N
SMILES:O(C(F)F)C1=C(CN)C=C(F)C=C1
Synonyms:- Benzenemethanamine, 2-(difluoromethoxy)-5-fluoro-
- [2-(Difluoromethoxy)-5-fluorophenyl]methanamine
- 2-(Difluoromethoxy)-5-fluorobenzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Difluoromethoxy)-5-fluorobenzylamine
CAS:2-(Difluoromethoxy)-5-fluorobenzylamineFormula:C8H8F3NOPurity:techColor and Shape:LiquidMolecular weight:191.15042
