CymitQuimica logo

CAS 1017783-07-1

:

methyl 4-(1,3-thiazolan-2-yl)benzenecarboxylate

Description:
Methyl 4-(1,3-thiazolan-2-yl)benzenecarboxylate is an organic compound characterized by its unique structure, which includes a methyl ester functional group and a thiazole ring. The thiazole moiety contributes to its potential biological activity, as thiazoles are often found in various pharmaceuticals and agrochemicals. This compound typically exhibits moderate to high solubility in organic solvents, while its solubility in water may vary depending on the specific conditions. It may possess a range of functional properties, including potential antimicrobial or antifungal activities, due to the presence of the thiazole ring. The compound's molecular structure allows for various chemical reactions, making it a candidate for further synthetic modifications. Safety data, including toxicity and handling precautions, should be consulted from reliable sources, as specific information may vary. Overall, methyl 4-(1,3-thiazolan-2-yl)benzenecarboxylate represents a class of compounds with diverse applications in medicinal chemistry and material science.
Formula:C11H13NO2S
InChI:InChI=1S/C11H13NO2S/c1-14-11(13)9-4-2-8(3-5-9)10-12-6-7-15-10/h2-5,10,12H,6-7H2,1H3
InChI key:UAWWTAKFPLAVCK-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=C(C=C1)C2NCCS2
Synonyms:
  • Benzoic acid, 4-(2-thiazolidinyl)-, methyl ester
  • methyl 4-(1,3-thiazolan-2-yl)benzenecarboxylate
Found 1 products.