
CAS 1017969-33-3
:Methyl 2,3-dihydro-3-oxo-8-isoquinolinecarboxylate
Description:
Methyl 2,3-dihydro-3-oxo-8-isoquinolinecarboxylate is a chemical compound characterized by its isoquinoline structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. This substance features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 2,3-dihydro-3-oxo moiety indicates that it has a ketone functional group, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. The compound may exhibit biological activity, as many isoquinoline derivatives are known for their pharmacological properties. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, the compound's characteristics, such as melting point, boiling point, and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, Methyl 2,3-dihydro-3-oxo-8-isoquinolinecarboxylate represents a versatile scaffold for further chemical exploration and potential applications in various fields.
Formula:C11H9NO3
InChI:InChI=1S/C11H9NO3/c1-15-11(14)8-4-2-3-7-5-10(13)12-6-9(7)8/h2-6H,1H3,(H,12,13)
InChI key:InChIKey=KXZNTWDCVPZJJF-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C=2C(C=CC1)=CC(=O)NC2
Synonyms:- Methyl 2,3-dihydro-3-oxo-8-isoquinolinecarboxylate
- 8-Isoquinolinecarboxylic acid, 2,3-dihydro-3-oxo-, methyl ester
- Methyl 3-hydroxyisoquinoline-8-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
