CAS 1018-79-7
:1,4-Dihydroxy-2,3-naphthalenedicarbonitrile
Description:
1,4-Dihydroxy-2,3-naphthalenedicarbonitrile, with the CAS number 1018-79-7, is an organic compound characterized by its naphthalene backbone, which features two hydroxyl groups and two cyano groups. This compound typically appears as a solid and is known for its potential applications in various fields, including organic synthesis and materials science. The presence of hydroxyl groups contributes to its ability to engage in hydrogen bonding, influencing its solubility and reactivity. The cyano groups, being electron-withdrawing, can enhance the compound's reactivity in nucleophilic substitution reactions. Additionally, the structural arrangement of the naphthalene ring system imparts unique electronic properties, making it of interest in the development of dyes, pigments, and other functional materials. Its synthesis and handling require careful consideration of safety protocols due to the toxicity associated with cyanide derivatives. Overall, 1,4-Dihydroxy-2,3-naphthalenedicarbonitrile is a versatile compound with significant implications in chemical research and industrial applications.
Formula:C12H6N2O2
InChI:InChI=1S/C12H6N2O2/c13-5-9-10(6-14)12(16)8-4-2-1-3-7(8)11(9)15/h1-4,15-16H
InChI key:InChIKey=JJBQXTABLSZHGC-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(O)=C(C#N)C1C#N)C=CC=C2
Synonyms:- 1,4-Dihydroxy-2,3-dicyanonaphthalene
- 1,4-Dihydroxy-2,3-naphthalenedicarbonitrile
- 2,3-Dicyano-1,4-dihydroxynaphthalene
- 2,3-Dicyano-1,4-naphthohydroquinone
- 2,3-Dicyanonaphthalene-1,4-diol
- 2,3-Naphthalenedicarbonitrile, 1,4-dihydroxy-
- NSC 128281
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1,4-Dihydroxynaphthalene-2,3-dicarbonitrile
CAS:1,4-Dihydroxynaphthalene-2,3-dicarbonitrileFormula:C12H6N2O2Purity:≥95%Molecular weight:210.192,3-NAPHTHALENEDICARBONITRILE, 1,4-DIHYDROXY-
CAS:Formula:C12H6N2O2Purity:95%Color and Shape:SolidMolecular weight:210.18821,4-Dihydroxy-2,3-naphthalenedicarbonitrile
CAS:Formula:(HO)2C10H4(CN)2Purity:(HPLC) ≥ 97.0%Color and Shape:Brown crystalline powder or crystalsMolecular weight:210.191,4-Dihydroxy-2,3-naphthalenedicarbonitrile
CAS:1,4-Dihydroxy-2,3-naphthalenedicarbonitrile is a synthetic molecule that has been used as a catalyst in organic synthesis. It can also be found in nature as a metabolite of the plant species Dichapetalum cymosum. It was first synthesized by Ludwig Knorr and is an example of a functional theory reaction. The technique for its synthesis involves condensing 1,4-dihydoxybenzene with nitroethane in the presence of triazole to produce the desired product. 1,4-Dihydroxy-2,3-naphthalenedicarbonitrile is also used as an antibiotic to treat P. aeruginosa infections and azide production from nitroglycerin and other explosive compounds.Formula:C12H6N2O2Purity:Min. 95%Color and Shape:PowderMolecular weight:210.19 g/mol





