CAS 10180-88-8
:hydroxyachillin
Description:
Hydroxyachillin, with the CAS number 10180-88-8, is a chemical compound that belongs to the class of natural products known as flavonoids. It is characterized by its phenolic structure, which contributes to its potential antioxidant properties. Hydroxyachillin is often studied for its biological activities, including anti-inflammatory and antimicrobial effects. The compound is soluble in organic solvents and exhibits moderate solubility in water, which can influence its bioavailability and application in various fields, including pharmaceuticals and nutraceuticals. Its molecular structure typically includes hydroxyl groups that enhance its reactivity and interaction with biological systems. Additionally, hydroxyachillin may play a role in plant defense mechanisms, contributing to the overall health of the plant. Research into its pharmacological properties continues to expand, highlighting its potential therapeutic applications. However, specific studies and data on its efficacy and safety are essential for understanding its full potential in medicinal chemistry.
Formula:C15H18O4
InChI:InChI=1/C15H18O4/c1-6-4-10(17)13-8(3)15(18)19-14(13)12-7(2)5-9(16)11(6)12/h5,8,10,12-14,17H,4H2,1-3H3/t8-,10-,12+,13+,14+/m0/s1
Synonyms:- 8-Deacetylmatricarin
- Austricin
- Deacetylmatricarin
- Desacetylmatricarin
- Matricarin, deacetyl-
- Nsc 180030
- Azuleno(4,5-b)furan-2,7-dione, 3,3a,4,5,9a,9b-hexahydro-4-hydroxy-3,6,9-trimethyl-, (3S,3aR,4S,9aS,9bR)-
- Azuleno(4,5-b)furan-2,7-dione, 3,3a,4,5,9a,9b-hexahydro-4-hydroxy-3,6,9-trimethyl-, (3S-(3alpha,3aalpha,4alpha,9aalpha,9bbeta))- (9CI)
- Guaia-1(10),3-dien-12-oic acid, 6alpha,8alpha-dihydroxy-2-oxo-, 12,6-lactone, (11S)- (8CI)
- 4-Hydroxy-3,6,9-Trimethyl-3,3A,4,5,9A,9B-Hexahydroazuleno[4,5-B]Furan-2,7-Dione
- (3S,3aR,4S,9aR,9bR)-4-hydroxy-3,6,9-trimethyl-3,3a,4,5,9a,9b-hexahydroazuleno[4,5-b]furan-2,7-dione
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Desacetylmatricarin
CAS:Desacetylmatricarin: anti-allergic, inhibits beta-hexosaminidase release in RBL-2H3 cells, IC50=7.5µM.Formula:C15H18O4Purity:98%Color and Shape:SolidMolecular weight:262.305Deacetylmatricarin
CAS:Deacetylmatricarin is a sesquiterpene lactone, which is a naturally occurring compound commonly found in plants such as chamomile. Its source is predominantly the aerial parts of certain Asteraceae family members. The mode of action of deacetylmatricarin involves its ability to modulate biological pathways, primarily through interactions with cellular signaling mechanisms that govern inflammation and cellular growth.
Formula:C15H18O4Purity:Min. 95%Color and Shape:PowderMolecular weight:262.3 g/mol



