CAS 1018127-41-7

3-cyclopropyl-6-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

Description:

3-Cyclopropyl-6-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid is a heterocyclic compound characterized by its complex structure, which includes a pyrazolo-pyridine core. This compound features a cyclopropyl group and a phenyl group, contributing to its unique chemical properties and potential biological activity. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions and may exhibit polar characteristics, influencing its solubility in various solvents. The compound's structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. Its specific stereochemistry and substituents can significantly affect its pharmacological profile, including potency and selectivity. Additionally, the compound may exhibit interesting properties such as fluorescence or reactivity under certain conditions, which could be explored in various applications, including organic synthesis and material science. Overall, 3-cyclopropyl-6-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid represents a valuable compound for further research in both chemical and biological fields.

Formula: C₁₇H₁₅N₃O₂

InChI: InChI=1S/C17H15N3O2/c1-10-9-13(17(21)22)14-15(11-7-8-11)19-20(16(14)18-10)12-5-3-2-4-6-12/h2-6,9,11H,7-8H2,1H3,(H,21,22)

InChI key: HVYMFRFJECULBQ-UHFFFAOYSA-N

SMILES: CC1=CC(=C2C(=NN(C2=N1)C3=CC=CC=C3)C4CC4)C(=O)O

Synonyms:

• 3-cyclopropyl-6-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
• 1H-Pyrazolo[3,4-b]pyridine-4-carboxylic acid, 3-cyclopropyl-6-methyl-1-phenyl-

3-Cyclopropyl-6-methyl-1-phenyl-1H-pyrazolo[3,4-b]pyridine-4-carboxylic acid

CAS: 1018127-41-7

Versatile small molecule scaffold

Formula: C₁₇H₁₅N₃O₂

Purity: Min. 95%

Molecular weight: 293.32 g/mol

Ref: 3D-TQB12741