CymitQuimica logo

CAS 1018293-21-4

:

(3-Oxo-2,3-dihydro-pyrido[3,2-b][1,4]oxazin-4-yl)-acetic acid

Description:
The chemical substance known as (3-Oxo-2,3-dihydro-pyrido[3,2-b][1,4]oxazin-4-yl)-acetic acid, with the CAS number 1018293-21-4, is a heterocyclic compound featuring a pyridine and oxazine ring system. This compound is characterized by its complex structure, which includes a ketone functional group and an acetic acid moiety. The presence of the oxazine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound may exhibit various properties such as solubility in polar solvents, depending on its functional groups, and it may participate in hydrogen bonding due to the presence of acidic and basic sites. Its unique structure suggests potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature, which are important considerations in its handling and application in research.
Formula:C9H8N2O4
InChI:InChI=1S/C9H8N2O4/c12-7-5-15-6-2-1-3-10-9(6)11(7)4-8(13)14/h1-3H,4-5H2,(H,13,14)
InChI key:BMIBNAOWFBFGRN-UHFFFAOYSA-N
SMILES:C1C(=O)N(C2=C(O1)C=CC=N2)CC(=O)O
Synonyms:
  • 2-(3-Oxopyrido[3,2-B][1,4]Oxazin-4-Yl)Acetic Acid
Found 3 products.