CAS 101832-73-9
:2,3-dimethyl-1H-indol-7-amine
Description:
2,3-Dimethyl-1H-indol-7-amine is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of two methyl groups at the 2 and 3 positions of the indole ring contributes to its unique chemical properties, while the amino group at the 7 position enhances its reactivity and potential for forming hydrogen bonds. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group. It is of interest in various fields, including medicinal chemistry, due to its potential biological activity and applications in drug development. The compound may also participate in various chemical reactions, such as electrophilic substitutions, owing to the electron-rich nature of the indole ring. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,3-dimethyl-1H-indol-7-amine represents a versatile building block in organic synthesis and pharmaceutical research.
Formula:C10H12N2
InChI:InChI=1/C10H12N2/c1-6-7(2)12-10-8(6)4-3-5-9(10)11/h3-5,12H,11H2,1-2H3
SMILES:Cc1c(C)[nH]c2c1cccc2N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
2,3-Dimethyl-1H-indol-7-amine
CAS:2,3-Dimethyl-1H-indol-7-amineFormula:C10H12N2Purity:97%Molecular weight:160.215682,3-Dimethyl-1H-indol-7-amine
CAS:2,3-Dimethyl-1H-indol-7-amine is an organic compound that belongs to the group of ethyl acetoacetate esters. It is a colorless liquid with a sweet odor and can be used as a solvent and in the manufacture of other compounds such as dibenzoylmethane. 2,3-Dimethyl-1H-indol-7-amine reacts with acetylacetone to form acetoacetic acid, which is then catalyzed by alcohol dehydrogenase to form oxaloacetate. This reaction also produces acetoacetate, which is oxidized by the enzyme dibenzoylmethane to form benzaldehyde.
Formula:C10H12N2Purity:Min. 95%Color and Shape:PowderMolecular weight:160.22 g/mol


