CAS 101861-63-6
:4,6-Dichloro-1H-indole-2-carboxylic acid
Description:
4,6-Dichloro-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features two chlorine atoms located at the 4 and 6 positions of the indole ring, contributing to its reactivity and potential biological activity. The presence of a carboxylic acid functional group at the 2 position enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. This compound is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. Additionally, its unique structural features may impart specific properties such as antimicrobial or anti-inflammatory activities. As with many halogenated compounds, it is essential to handle 4,6-Dichloro-1H-indole-2-carboxylic acid with care, considering the potential environmental and health impacts associated with chlorine-containing substances.
Formula:C9H5Cl2NO2
InChI:InChI=1/C9H5Cl2NO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14)
SMILES:c1c(cc2c(cc(C(=O)O)[nH]2)c1Cl)Cl
Synonyms:- 4,6-Dichloroindole-2-Carboxylic Acid
- 4,6-Dicloroindole-2-carboxylic acid
- 4,6-Dicloroindole-2-Carboxylic
- 4,6-Dichloroindole-2-carboxylic
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4,6-Dichloroindole-2-carboxylic acid
CAS:4,6-Dichloroindole-2-carboxylic acidFormula:C9H5Cl2NO2Purity:98%Molecular weight:230.051H-Indole-2-carboxylic acid, 4,6-dichloro-
CAS:Formula:C9H5Cl2NO2Purity:95%Color and Shape:SolidMolecular weight:230.04754,6-Dichloroindole-2-carboxylic acid
CAS:4,6-Dichloroindole-2-carboxylic acid (DCI) is a potential drug candidate for the treatment of neurological disorders. DCI binds to glutamate receptors, which are involved in many neurological diseases. It has been shown to inhibit glutamate dehydrogenase and thus block the production of glutamate from glucose. DCI also prevents neuronal death caused by excessive levels of glutamate and inhibits the activation of N-methyl-D-aspartate (NMDA) receptors. This drug is currently being investigated as a therapy for inflammatory diseases such as multiple sclerosis and Alzheimer's disease. One study has shown that DCI may be useful for treating cerebellar granule cells in a model system. It has been found to inhibit glycogen synthase kinase 3, which is an enzyme involved in signaling pathways that regulate cell growth and survival.Formula:C9H5Cl2NO2Purity:Min. 95%Color and Shape:White PowderMolecular weight:230.05 g/mol4,6-Dichloro-1H-indole-2-carboxylic acid
CAS:Formula:C9H5Cl2NO2Purity:95%Color and Shape:SolidMolecular weight:230.04



