CymitQuimica logo

CAS 101861-63-6

:

4,6-Dichloro-1H-indole-2-carboxylic acid

Description:
4,6-Dichloro-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This substance features two chlorine atoms located at the 4 and 6 positions of the indole ring, contributing to its reactivity and potential biological activity. The presence of a carboxylic acid functional group at the 2 position enhances its solubility in polar solvents and allows for potential interactions in biochemical pathways. This compound is often studied for its applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its ability to interact with various biological targets. Additionally, its unique structural features may impart specific properties such as antimicrobial or anti-inflammatory activities. As with many halogenated compounds, it is essential to handle 4,6-Dichloro-1H-indole-2-carboxylic acid with care, considering the potential environmental and health impacts associated with chlorine-containing substances.
Formula:C9H5Cl2NO2
InChI:InChI=1/C9H5Cl2NO2/c10-4-1-6(11)5-3-8(9(13)14)12-7(5)2-4/h1-3,12H,(H,13,14)
InChI key:DHXISZKSSIWRLH-UHFFFAOYSA-N
SMILES:c1c(cc2c(cc(C(=O)O)[nH]2)c1Cl)Cl
Synonyms:
  • 4,6-Dichloroindole-2-Carboxylic Acid
  • 4,6-Dicloroindole-2-carboxylic acid
  • 4,6-Dicloroindole-2-Carboxylic
  • 4,6-Dichloroindole-2-carboxylic
Found 4 products.