CymitQuimica logo

CAS 1018678-48-2

:

Benzoicacid,1-(difluoromethyl)-methylester

Description:
Benzoic acid, 1-(difluoromethyl)-methyl ester, identified by the CAS number 1018678-48-2, is an organic compound characterized by its ester functional group derived from benzoic acid. This compound features a benzoate structure with a difluoromethyl group attached to the carbon adjacent to the ester linkage, which significantly influences its chemical properties. The presence of fluorine atoms typically enhances the compound's lipophilicity and can affect its reactivity and stability. Benzoic acid derivatives are often utilized in various applications, including as intermediates in organic synthesis, in pharmaceuticals, and as potential agrochemicals. The compound may exhibit specific biological activities, making it of interest in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions influenced by the difluoromethyl group and the aromatic ring. Safety and handling considerations are essential, as with many organic compounds, particularly those containing halogens. Overall, this compound represents a unique structure within the benzoic acid derivative family, with potential applications in diverse fields.
Formula:C9H8F2O2
InChI:InChI=1S/C9H8F2O2/c1-13-9(12)7-5-3-2-4-6(7)8(10)11/h2-5,8H,1H3
InChI key:KGOFBYAEKGHAQG-UHFFFAOYSA-N
SMILES:COC(=O)C1=CC=CC=C1C(F)F
Synonyms:
  • Benzoic acid,1-(difluoromethyl)-methyl ester
Found 4 products.