CymitQuimica logo

CAS 101896-25-7

:

Phenoxazin-5-ium, 7-amino-3,6,10-triethyl-2-(ethylimino)-2,10-dihydro-, perchlorate

Description:
Phenoxazin-5-ium, 7-amino-3,6,10-triethyl-2-(ethylimino)-2,10-dihydro-, perchlorate is a complex organic compound characterized by its phenoxazine core structure, which is a tricyclic aromatic system. This compound features multiple functional groups, including an amino group and an ethylimino substituent, contributing to its chemical reactivity and potential biological activity. The presence of triethyl groups enhances its solubility in organic solvents and may influence its interaction with biological systems. As a perchlorate salt, it is associated with the perchlorate anion, which can impart specific properties such as increased stability and solubility in certain solvents. The compound may exhibit fluorescence properties, making it of interest in various applications, including dye chemistry and biological imaging. Its unique structure suggests potential uses in pharmaceuticals or as a dye, although specific applications would depend on further research into its biological activity and stability under different conditions. Safety and handling precautions should be observed due to the presence of perchlorate, which can be hazardous in certain contexts.
Formula:C20H26N3O·ClO4
InChI:InChI=1S/C20H26N3O.ClHO4/c1-5-13-11-19-18(12-16(13)22-7-3)23(8-4)17-10-9-15(21)14(6-2)20(17)24-19;2-1(3,4)5/h9-12H,5-8,21H2,1-4H3;(H,2,3,4,5)/q+1;/p-1
InChI key:InChIKey=AWOSNSWGHWENJI-UHFFFAOYSA-M
SMILES:C(C)N1C=2C(=C(CC)C(N)=CC2)[O+]=C3C1=CC(=NCC)C(CC)=C3.Cl(=O)(=O)(=O)[O-]
Synonyms:
  • Phenoxazin-5-ium, 7-amino-3,6,10-triethyl-2-(ethylimino)-2,10-dihydro-, perchlorate
  • 7-Amino-3,6,10-triethyl-2-(ethylimino)-2,10-dihydrophenoxazin-5-ium perchlorate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.